C35H21BrO — CID 156687550
4-[3-bromo-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)fluoren-9-yl]dibenzofuran (PubChem CID 156687550) has the molecular formula C35H21BrO and a molecular weight of 544.50 g/mol. Its IUPAC name is 4-[3-bromo-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)fluoren-9-yl]dibenzofuran.
| Compound Name | 4-[3-bromo-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)fluoren-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 156687550 |
| Molecular Formula | C35H21BrO |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | 4-[3-bromo-9-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)fluoren-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(C3(c4cccc5c4oc4ccccc45)c4ccccc4-c4cc(Br)ccc43)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C35H21BrO/c36-25-18-19-31-29(21-25)26-10-3-5-13-30(26)35(31,24-17-16-22-8-1-2-9-23(22)20-24)32-14-7-12-28-27-11-4-6-15-33(27)37-34(28)32/h1-21H/i1D,2D,8D,9D,16D,17D,20D |
| InChIKey | AKVCTSJZXQBGRK-DFEMWBAHSA-N |
| XLogP | 9.86 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |