C42H26O — CID 164737877
4-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]anthracen-9-yl]dibenzofuran (PubChem CID 164737877) has the molecular formula C42H26O and a molecular weight of 561.76 g/mol. Its IUPAC name is 4-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]anthracen-9-yl]dibenzofuran.
| Compound Name | 4-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 164737877 |
| Molecular Formula | C42H26O |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 4-[1,2,3,4,5,6,7,8-octadeuterio-10-[4-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)phenyl]anthracen-9-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3ccc(-c4c5c([2H])c([2H])c([2H])c([2H])c5c(-c5cccc6c5oc5ccccc56)c5c([2H])c([2H])c([2H])c([2H])c45)cc3)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C42H26O/c1-2-11-30-26-31(25-22-27(30)10-1)28-20-23-29(24-21-28)40-33-13-3-5-15-35(33)41(36-16-6-4-14-34(36)40)38-18-9-17-37-32-12-7-8-19-39(32)43-42(37)38/h1-26H/i1D,2D,3D,4D,5D,6D,10D,11D,13D,14D,15D,16D,22D,25D,26D |
| InChIKey | ZBQIWZKMKGOZJH-RYZWQWETSA-N |
| XLogP | 12.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|