C40H24O — CID 166501557
7-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran (PubChem CID 166501557) has the molecular formula C40H24O and a molecular weight of 535.72 g/mol. Its IUPAC name is 7-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran.
| Compound Name | 7-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 166501557 |
| Molecular Formula | C40H24O |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 7-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4cccc5oc6c7ccccc7ccc6c45)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C40H24O/c1-2-12-27-24-28(21-20-25(27)10-1)37-30-14-5-7-16-32(30)38(33-17-8-6-15-31(33)37)34-18-9-19-36-39(34)35-23-22-26-11-3-4-13-29(26)40(35)41-36/h1-24H/i1D,2D,5D,6D,7D,8D,10D,12D,14D,15D,16D,17D,20D,21D,24D |
| InChIKey | QVZOHNVSMLMEAU-VFGSFBFBSA-N |
| XLogP | 11.53 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|