C48H30O — CID 170653986
7-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran (PubChem CID 170653986) has the molecular formula C48H30O and a molecular weight of 632.83 g/mol. Its IUPAC name is 7-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran.
| Compound Name | 7-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 170653986 |
| Molecular Formula | C48H30O |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 7-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc(-c3c4ccccc4c(-c4cccc5oc6c7ccccc7ccc6c45)c4ccccc34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H30O/c1-3-14-31(15-4-1)34-28-35(32-16-5-2-6-17-32)30-36(29-34)45-38-20-9-11-22-40(38)46(41-23-12-10-21-39(41)45)42-24-13-25-44-47(42)43-27-26-33-18-7-8-19-37(33)48(43)49-44/h1-30H/i1D,2D,3D,4D,5D,6D,14D,15D,16D,17D |
| InChIKey | BZMQMRWVUBYZFE-CMXGOFMVSA-N |
| XLogP | 13.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|