C48H30O — CID 170654064
3-phenyl-7-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran (PubChem CID 170654064) has the molecular formula C48H30O and a molecular weight of 631.82 g/mol. Its IUPAC name is 3-phenyl-7-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran.
| Compound Name | 3-phenyl-7-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 170654064 |
| Molecular Formula | C48H30O |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | 3-phenyl-7-[10-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]anthracen-9-yl]naphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3c4ccccc4c(-c4cccc5oc6c7ccc(-c8ccccc8)cc7ccc6c45)c4ccccc34)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C48H30O/c1-3-12-31(13-4-1)33-22-24-34(25-23-33)45-38-16-7-9-18-40(38)46(41-19-10-8-17-39(41)45)42-20-11-21-44-47(42)43-29-27-36-30-35(32-14-5-2-6-15-32)26-28-37(36)48(43)49-44/h1-30H/i1D,3D,4D,12D,13D,22D,23D,24D,25D |
| InChIKey | AFKOYAONKUTLJY-CWCHBHSWSA-N |
| XLogP | 13.71 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|