C46H28O — CID 177072178
7-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)-3-phenylnaphtho[1,2-b][1]benzofuran (PubChem CID 177072178) has the molecular formula C46H28O and a molecular weight of 604.78 g/mol. Its IUPAC name is 7-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)-3-phenylnaphtho[1,2-b][1]benzofuran.
| Compound Name | 7-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)-3-phenylnaphtho[1,2-b][1]benzofuran |
|---|---|
| PubChem CID | 177072178 |
| Molecular Formula | C46H28O |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 7-(1,2,3,4,5,6,7,8-octadeuterio-10-naphthalen-2-ylanthracen-9-yl)-3-phenylnaphtho[1,2-b][1]benzofuran |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4oc5c6ccc(-c7ccccc7)cc6ccc5c34)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4ccccc4c3)c2c1[2H] |
| InChI | InChI=1S/C46H28O/c1-2-11-29(12-3-1)32-23-25-35-33(27-32)24-26-41-45-40(19-10-20-42(45)47-46(35)41)44-38-17-8-6-15-36(38)43(37-16-7-9-18-39(37)44)34-22-21-30-13-4-5-14-31(30)28-34/h1-28H/i6D,7D,8D,9D,15D,16D,17D,18D |
| InChIKey | FAUNUGIBKVZKOQ-SEUGGBKUSA-N |
| XLogP | 13.20 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|