C40H22O2 — CID 51348613
4-(2,3,4,5,7,8,9,10-octadeuterio-6-dibenzofuran-4-ylpyren-1-yl)dibenzofuran (PubChem CID 51348613) has the molecular formula C40H22O2 and a molecular weight of 542.66 g/mol. Its IUPAC name is 4-(2,3,4,5,7,8,9,10-octadeuterio-6-dibenzofuran-4-ylpyren-1-yl)dibenzofuran.
| Compound Name | 4-(2,3,4,5,7,8,9,10-octadeuterio-6-dibenzofuran-4-ylpyren-1-yl)dibenzofuran |
|---|---|
| PubChem CID | 51348613 |
| Molecular Formula | C40H22O2 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 4-(2,3,4,5,7,8,9,10-octadeuterio-6-dibenzofuran-4-ylpyren-1-yl)dibenzofuran |
| SMILES | [2H]c1c([2H])c2c([2H])c([2H])c3c(-c4cccc5c4oc4ccccc45)c([2H])c([2H])c4c([2H])c([2H])c(c1-c1cccc5c1oc1ccccc15)c2c43 |
| InChI | InChI=1S/C40H22O2/c1-3-13-35-27(7-1)33-11-5-9-31(39(33)41-35)25-19-15-23-18-22-30-26(20-16-24-17-21-29(25)37(23)38(24)30)32-10-6-12-34-28-8-2-4-14-36(28)42-40(32)34/h1-22H/i15D,16D,17D,18D,19D,20D,21D,22D |
| InChIKey | QKHRSOQPEOBXAJ-UFKOAQLDSA-N |
| XLogP | 11.72 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|