C54H32O2 — CID 140831499
2-dibenzofuran-4-yl-1-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-1-yl]dibenzofuran (PubChem CID 140831499) has the molecular formula C54H32O2 and a molecular weight of 717.88 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-1-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-1-yl]dibenzofuran.
| Compound Name | 2-dibenzofuran-4-yl-1-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-1-yl]dibenzofuran |
|---|---|
| PubChem CID | 140831499 |
| Molecular Formula | C54H32O2 |
| Molecular Weight | 717.88 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | 2-dibenzofuran-4-yl-1-[5-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]naphthalen-1-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cccc4c(-c5c(-c6cccc7c6oc6ccccc67)ccc6oc7ccccc7c56)cccc34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C54H32O2/c1-2-15-33(16-3-1)50-39-18-4-6-20-41(39)51(42-21-7-5-19-40(42)50)37-25-12-24-35-34(37)23-13-26-38(35)52-43(31-32-49-53(52)46-22-9-11-30-48(46)55-49)45-28-14-27-44-36-17-8-10-29-47(36)56-54(44)45/h1-32H/i1D,2D,3D,15D,16D |
| InChIKey | GBCYWVQEGNMPCI-NVQYRDKCSA-N |
| XLogP | 15.61 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.88 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|