C50H30OS — CID 162423645
4-[1-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzothiophen-2-yl]dibenzofuran (PubChem CID 162423645) has the molecular formula C50H30OS and a molecular weight of 683.89 g/mol. Its IUPAC name is 4-[1-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzothiophen-2-yl]dibenzofuran.
| Compound Name | 4-[1-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzothiophen-2-yl]dibenzofuran |
|---|---|
| PubChem CID | 162423645 |
| Molecular Formula | C50H30OS |
| Molecular Weight | 683.89 g/mol |
| Exact Mass | 683.23 |
| IUPAC Name | 4-[1-[3-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]phenyl]dibenzothiophen-2-yl]dibenzofuran |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cccc(-c4c(-c5cccc6c5oc5ccccc56)ccc5sc6ccccc6c45)c3)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C50H30OS/c1-2-14-31(15-3-1)46-35-19-4-6-21-37(35)47(38-22-7-5-20-36(38)46)32-16-12-17-33(30-32)48-39(28-29-45-49(48)42-23-9-11-27-44(42)52-45)41-25-13-24-40-34-18-8-10-26-43(34)51-50(40)41/h1-30H/i1D,2D,3D,14D,15D |
| InChIKey | XJFSRJTYDIHJPI-IRYSBDQPSA-N |
| XLogP | 14.93 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.89 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|