C38H22O2 — CID 129119405
12-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (PubChem CID 129119405) has the molecular formula C38H22O2 and a molecular weight of 515.62 g/mol. Its IUPAC name is 12-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene.
| Compound Name | 12-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 129119405 |
| Molecular Formula | C38H22O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 12-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,20-dioxapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cc4oc5ccccc5c4c4oc5ccccc5c34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C38H22O2/c1-2-12-23(13-3-1)34-24-14-4-6-16-26(24)35(27-17-7-5-15-25(27)34)30-22-33-37(29-19-9-10-20-31(29)39-33)38-36(30)28-18-8-11-21-32(28)40-38/h1-22H/i1D,2D,3D,12D,13D |
| InChIKey | CKECYFWPYLDRLF-AYAICNHJSA-N |
| XLogP | 11.13 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|