C42H24O2 — CID 164817981
11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,17-dioxahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene (PubChem CID 164817981) has the molecular formula C42H24O2 and a molecular weight of 565.68 g/mol. Its IUPAC name is 11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,17-dioxahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene.
| Compound Name | 11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,17-dioxahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene |
|---|---|
| PubChem CID | 164817981 |
| Molecular Formula | C42H24O2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 11-[10-(2,3,4,5,6-pentadeuteriophenyl)anthracen-9-yl]-9,17-dioxahexacyclo[11.11.0.02,10.03,8.016,24.018,23]tetracosa-1,3,5,7,10,12,14,16(24),18,20,22-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3ccccc3c(-c3cc4ccc5oc6ccccc6c5c4c4c3oc3ccccc34)c3ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C42H24O2/c1-2-12-25(13-3-1)37-27-14-4-6-16-29(27)39(30-17-7-5-15-28(30)37)33-24-26-22-23-36-40(31-18-8-10-20-34(31)43-36)38(26)41-32-19-9-11-21-35(32)44-42(33)41/h1-24H/i1D,2D,3D,12D,13D |
| InChIKey | ALERJKPQDCHYEB-AYAICNHJSA-N |
| XLogP | 12.28 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|