C75H51N — CID 164783664
9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis[4-(9-phenylfluoren-9-yl)phenyl]fluoren-2-amine (PubChem CID 164783664) has the molecular formula C75H51N and a molecular weight of 976.30 g/mol. Its IUPAC name is 9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis[4-(9-phenylfluoren-9-yl)phenyl]fluoren-2-amine.
| Compound Name | 9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis[4-(9-phenylfluoren-9-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 164783664 |
| Molecular Formula | C75H51N |
| Molecular Weight | 976.30 g/mol |
| Exact Mass | 975.46 |
| IUPAC Name | 9,9-bis(2,3,4,5,6-pentadeuteriophenyl)-N,N-bis[4-(9-phenylfluoren-9-yl)phenyl]fluoren-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccccc3-c3ccc(N(c4ccc(C5(c6ccccc6)c6ccccc6-c6ccccc65)cc4)c4ccc(C5(c6ccccc6)c6ccccc6-c6ccccc65)cc4)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C75H51N/c1-5-23-52(24-6-1)73(67-36-18-13-31-61(67)62-32-14-19-37-68(62)73)56-41-45-58(46-42-56)76(59-47-43-57(44-48-59)74(53-25-7-2-8-26-53)69-38-20-15-33-63(69)64-34-16-21-39-70(64)74)60-49-50-66-65-35-17-22-40-71(65)75(72(66)51-60,54-27-9-3-10-28-54)55-29-11-4-12-30-55/h1-51H/i3D,4D,9D,10D,11D,12D,27D,28D,29D,30D |
| InChIKey | ILLYEWAWDDJBNU-KBZRQLQQSA-N |
| XLogP | 18.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.30 |
| LogP ≤ 5 | 18.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |