C56H39N — CID 164783967
N-(9,9-diphenylfluoren-2-yl)-9,9-diphenyl-N-(2,4,6-trideuteriophenyl)fluoren-2-amine (PubChem CID 164783967) has the molecular formula C56H39N and a molecular weight of 728.95 g/mol. Its IUPAC name is N-(9,9-diphenylfluoren-2-yl)-9,9-diphenyl-N-(2,4,6-trideuteriophenyl)fluoren-2-amine.
| Compound Name | N-(9,9-diphenylfluoren-2-yl)-9,9-diphenyl-N-(2,4,6-trideuteriophenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 164783967 |
| Molecular Formula | C56H39N |
| Molecular Weight | 728.95 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | N-(9,9-diphenylfluoren-2-yl)-9,9-diphenyl-N-(2,4,6-trideuteriophenyl)fluoren-2-amine |
| SMILES | [2H]c1cc([2H])c(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)c([2H])c1 |
| InChI | InChI=1S/C56H39N/c1-6-20-40(21-7-1)55(41-22-8-2-9-23-41)51-32-18-16-30-47(51)49-36-34-45(38-53(49)55)57(44-28-14-5-15-29-44)46-35-37-50-48-31-17-19-33-52(48)56(54(50)39-46,42-24-10-3-11-25-42)43-26-12-4-13-27-43/h1-39H/i5D,28D,29D |
| InChIKey | LIQFXWWBHYEAKN-QBVDXFFXSA-N |
| XLogP | 13.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.95 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |