C31H21Br — CID 177098953
2-bromo-7-(2,3,4,5,6-pentadeuteriophenyl)-9,9-diphenylfluorene (PubChem CID 177098953) has the molecular formula C31H21Br and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-bromo-7-(2,3,4,5,6-pentadeuteriophenyl)-9,9-diphenylfluorene.
| Compound Name | 2-bromo-7-(2,3,4,5,6-pentadeuteriophenyl)-9,9-diphenylfluorene |
|---|---|
| PubChem CID | 177098953 |
| Molecular Formula | C31H21Br |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-bromo-7-(2,3,4,5,6-pentadeuteriophenyl)-9,9-diphenylfluorene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(Br)ccc2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C31H21Br/c32-26-17-19-28-27-18-16-23(22-10-4-1-5-11-22)20-29(27)31(30(28)21-26,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-21H/i1D,4D,5D,10D,11D |
| InChIKey | CMQWMZNNINVWGJ-ZWYOJXJXSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |