C51H34 — CID 164737939
9-phenyl-10-[2,3,5,6-tetradeuterio-4-(9,9-diphenylfluoren-2-yl)phenyl]anthracene (PubChem CID 164737939) has the molecular formula C51H34 and a molecular weight of 650.86 g/mol. Its IUPAC name is 9-phenyl-10-[2,3,5,6-tetradeuterio-4-(9,9-diphenylfluoren-2-yl)phenyl]anthracene.
| Compound Name | 9-phenyl-10-[2,3,5,6-tetradeuterio-4-(9,9-diphenylfluoren-2-yl)phenyl]anthracene |
|---|---|
| PubChem CID | 164737939 |
| Molecular Formula | C51H34 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | 9-phenyl-10-[2,3,5,6-tetradeuterio-4-(9,9-diphenylfluoren-2-yl)phenyl]anthracene |
| SMILES | [2H]c1c([2H])c(-c2c3ccccc3c(-c3ccccc3)c3ccccc23)c([2H])c([2H])c1-c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C51H34/c1-4-16-36(17-5-1)49-43-23-10-12-25-45(43)50(46-26-13-11-24-44(46)49)37-30-28-35(29-31-37)38-32-33-42-41-22-14-15-27-47(41)51(48(42)34-38,39-18-6-2-7-19-39)40-20-8-3-9-21-40/h1-34H/i28D,29D,30D,31D |
| InChIKey | WFDDCAWXVYSTLG-QYFQVZQBSA-N |
| XLogP | 13.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|