C51H34 — CID 164737933
9-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]phenyl]-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene (PubChem CID 164737933) has the molecular formula C51H34 and a molecular weight of 664.94 g/mol. Its IUPAC name is 9-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]phenyl]-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene.
| Compound Name | 9-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]phenyl]-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene |
|---|---|
| PubChem CID | 164737933 |
| Molecular Formula | C51H34 |
| Molecular Weight | 664.94 g/mol |
| Exact Mass | 664.38 |
| IUPAC Name | 9-[4-[9,9-bis(2,3,4,5,6-pentadeuteriophenyl)fluoren-2-yl]phenyl]-1,2,3,4,5,6,7,8-octadeuterio-10-phenylanthracene |
| SMILES | [2H]c1c([2H])c([2H])c(C2(c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3ccccc3-c3ccc(-c4ccc(-c5c6c([2H])c([2H])c([2H])c([2H])c6c(-c6ccccc6)c6c([2H])c([2H])c([2H])c([2H])c56)cc4)cc32)c([2H])c1[2H] |
| InChI | InChI=1S/C51H34/c1-4-16-36(17-5-1)49-43-23-10-12-25-45(43)50(46-26-13-11-24-44(46)49)37-30-28-35(29-31-37)38-32-33-42-41-22-14-15-27-47(41)51(48(42)34-38,39-18-6-2-7-19-39)40-20-8-3-9-21-40/h1-34H/i2D,3D,6D,7D,8D,9D,10D,11D,12D,13D,18D,19D,20D,21D,23D,24D,25D,26D |
| InChIKey | WFDDCAWXVYSTLG-UBCFCUAHSA-N |
| XLogP | 13.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.94 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|