C52H39N — CID 123342848
N-buta-1,3-dien-2-yl-N-[1-(3-ethenyl-2,2'-dimethyl-1,3'-spirobi[indene]-1'-yl)ethenyl]-9,9'-spirobi[fluorene]-2-amine (PubChem CID 123342848) has the molecular formula C52H39N and a molecular weight of 677.89 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N-[1-(3-ethenyl-2,2'-dimethyl-1,3'-spirobi[indene]-1'-yl)ethenyl]-9,9'-spirobi[fluorene]-2-amine.
| Compound Name | N-buta-1,3-dien-2-yl-N-[1-(3-ethenyl-2,2'-dimethyl-1,3'-spirobi[indene]-1'-yl)ethenyl]-9,9'-spirobi[fluorene]-2-amine |
|---|---|
| PubChem CID | 123342848 |
| Molecular Formula | C52H39N |
| Molecular Weight | 677.89 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N-[1-(3-ethenyl-2,2'-dimethyl-1,3'-spirobi[indene]-1'-yl)ethenyl]-9,9'-spirobi[fluorene]-2-amine |
| SMILES | C=CC(=C)N(C(=C)C1=C(C)C2(C(C)=C(C=C)c3ccccc32)c2ccccc21)c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2 |
| InChI | InChI=1S/C52H39N/c1-7-32(3)53(35(6)50-34(5)51(48-28-18-13-23-43(48)50)33(4)37(8-2)38-19-9-14-24-44(38)51)36-29-30-42-41-22-12-17-27-47(41)52(49(42)31-36)45-25-15-10-20-39(45)40-21-11-16-26-46(40)52/h7-31H,1-3,6H2,4-5H3 |
| InChIKey | BRHYHMDTGDGYQS-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.89 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|