C33H33N — CID 151739192
2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-amine (PubChem CID 151739192) has the molecular formula C33H33N and a molecular weight of 443.63 g/mol. Its IUPAC name is 2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-amine.
| Compound Name | 2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-amine |
|---|---|
| PubChem CID | 151739192 |
| Molecular Formula | C33H33N |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-amine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3-c3ccc(N)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C33H33N/c1-31(2,3)20-11-14-24-25-15-12-21(32(4,5)6)18-29(25)33(28(24)17-20)27-10-8-7-9-23(27)26-16-13-22(34)19-30(26)33/h7-19H,34H2,1-6H3 |
| InChIKey | RMEAIRNZBLBALO-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|