C33H31B — CID 174069072
CID 174069072 (PubChem CID 174069072) has the molecular formula C33H31B and a molecular weight of 438.42 g/mol.
| Compound Name | CID 174069072 |
|---|---|
| PubChem CID | 174069072 |
| Molecular Formula | C33H31B |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1-c1ccccc1C21c2cc(C(C)(C)C)ccc2-c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C33H31B/c1-31(2,3)20-14-16-22-23-17-15-21(32(4,5)6)19-28(23)33(27(22)18-20)25-11-8-7-10-24(25)30-26(33)12-9-13-29(30)34/h7-19H,1-6H3 |
| InChIKey | LOBGYLIUOPCVAJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|