C49H42N2 — CID 168908932
4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-4-yl)-2,6-diphenylpyrimidine (PubChem CID 168908932) has the molecular formula C49H42N2 and a molecular weight of 658.89 g/mol. Its IUPAC name is 4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-4-yl)-2,6-diphenylpyrimidine.
| Compound Name | 4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-4-yl)-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 168908932 |
| Molecular Formula | C49H42N2 |
| Molecular Weight | 658.89 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | 4-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-4-yl)-2,6-diphenylpyrimidine |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(C(C)(C)C)ccc3-2)c2ccccc2-c2c(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cccc21 |
| InChI | InChI=1S/C49H42N2/c1-47(2,3)33-24-26-35-36-27-25-34(48(4,5)6)29-42(36)49(41(35)28-33)39-22-14-13-20-37(39)45-38(21-15-23-40(45)49)44-30-43(31-16-9-7-10-17-31)50-46(51-44)32-18-11-8-12-19-32/h7-30H,1-6H3 |
| InChIKey | IOVSATOFCURLBO-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.89 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |