C63H57N3Si — CID 177087811
[4-[4-[3-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 177087811) has the molecular formula C63H57N3Si and a molecular weight of 884.26 g/mol. Its IUPAC name is [4-[4-[3-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[3-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177087811 |
| Molecular Formula | C63H57N3Si |
| Molecular Weight | 884.26 g/mol |
| Exact Mass | 883.43 |
| IUPAC Name | [4-[4-[3-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4cccc(-c5nc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccc([Si](C)(C)C)cc6)n5)c4)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C63H57N3Si/c1-61(2,3)47-29-34-52-53-35-30-48(62(4,5)6)39-57(53)63(56(52)38-47)54-21-14-13-20-50(54)51-33-28-45(37-55(51)63)44-18-15-19-46(36-44)60-65-58(42-24-22-41(23-25-42)40-16-11-10-12-17-40)64-59(66-60)43-26-31-49(32-27-43)67(7,8)9/h10-39H,1-9H3 |
| InChIKey | URZJWGQMMRQBBL-UHFFFAOYSA-N |
| XLogP | 15.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.26 |
| LogP ≤ 5 | 15.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|