C67H65N3Si — CID 177088032
trimethyl-[4-[4-phenyl-6-[3-[3-(2',7,7'-tritert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane (PubChem CID 177088032) has the molecular formula C67H65N3Si and a molecular weight of 940.36 g/mol. Its IUPAC name is trimethyl-[4-[4-phenyl-6-[3-[3-(2',7,7'-tritert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-phenyl-6-[3-[3-(2',7,7'-tritert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 177088032 |
| Molecular Formula | C67H65N3Si |
| Molecular Weight | 940.36 g/mol |
| Exact Mass | 939.49 |
| IUPAC Name | trimethyl-[4-[4-phenyl-6-[3-[3-(2',7,7'-tritert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]phenyl]-1,3,5-triazin-2-yl]phenyl]silane |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3cc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccc([Si](C)(C)C)cc7)n6)c5)c4)ccc3-2)c2cc(C(C)(C)C)ccc2-c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C67H65N3Si/c1-64(2,3)49-27-33-54-53-32-26-47(38-57(53)67(58(54)39-49)59-40-50(65(4,5)6)28-34-55(59)56-35-29-51(41-60(56)67)66(7,8)9)45-21-16-20-44(36-45)46-22-17-23-48(37-46)63-69-61(42-18-14-13-15-19-42)68-62(70-63)43-24-30-52(31-25-43)71(10,11)12/h13-41H,1-12H3 |
| InChIKey | UZXAIRUJBFWRIR-UHFFFAOYSA-N |
| XLogP | 16.99 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.36 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|