C57H55N3Si — CID 177088328
[4-[4-[4-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane (PubChem CID 177088328) has the molecular formula C57H55N3Si and a molecular weight of 810.17 g/mol. Its IUPAC name is [4-[4-[4-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[4-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177088328 |
| Molecular Formula | C57H55N3Si |
| Molecular Weight | 810.17 g/mol |
| Exact Mass | 809.42 |
| IUPAC Name | [4-[4-[4-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-trimethylsilane |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc([Si](C)(C)C)cc6)n5)cc4)cc32)cc1 |
| InChI | InChI=1S/C57H55N3Si/c1-55(2,3)43-26-30-45(31-27-43)57(46-32-28-44(29-33-46)56(4,5)6)50-18-14-13-17-48(50)49-36-25-42(37-51(49)57)38-19-21-40(22-20-38)53-58-52(39-15-11-10-12-16-39)59-54(60-53)41-23-34-47(35-24-41)61(7,8)9/h10-37H,1-9H3 |
| InChIKey | UPPVESNLQGALKC-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.17 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|