C64H51N3Si — CID 177088186
[7-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9,9-diphenylfluoren-2-yl]-trimethylsilane (PubChem CID 177088186) has the molecular formula C64H51N3Si and a molecular weight of 890.22 g/mol. Its IUPAC name is [7-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9,9-diphenylfluoren-2-yl]-trimethylsilane.
| Compound Name | [7-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9,9-diphenylfluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177088186 |
| Molecular Formula | C64H51N3Si |
| Molecular Weight | 890.22 g/mol |
| Exact Mass | 889.39 |
| IUPAC Name | [7-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]-9,9-diphenylfluoren-2-yl]-trimethylsilane |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cccc(-c6ccc7c(c6)C(c6ccccc6)(c6ccccc6)c6cc([Si](C)(C)C)ccc6-7)c5)c4)n3)cc21 |
| InChI | InChI=1S/C64H51N3Si/c1-63(2)56-30-16-15-29-52(56)53-35-32-48(40-57(53)63)62-66-60(42-19-9-6-10-20-42)65-61(67-62)47-24-18-23-45(38-47)43-21-17-22-44(37-43)46-31-34-54-55-36-33-51(68(3,4)5)41-59(55)64(58(54)39-46,49-25-11-7-12-26-49)50-27-13-8-14-28-50/h6-41H,1-5H3 |
| InChIKey | WSDPAOIYMSSGER-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.22 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|