C39H35N3Si — CID 177088154
[9,9-dimethyl-7-[3-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]fluoren-2-yl]-trimethylsilane (PubChem CID 177088154) has the molecular formula C39H35N3Si and a molecular weight of 578.85 g/mol. Its IUPAC name is [9,9-dimethyl-7-[3-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]fluoren-2-yl]-trimethylsilane.
| Compound Name | [9,9-dimethyl-7-[3-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]fluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177088154 |
| Molecular Formula | C39H35N3Si |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | [9,9-dimethyl-7-[3-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]fluoren-2-yl]-trimethylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)C(C)(C)c4cc([Si](C)(C)C)ccc4-5)c3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H35N3Si/c1-39(2)34-24-29(19-21-32(34)33-22-20-31(25-35(33)39)43(3,4)5)28-17-12-18-30(23-28)38-41-36(26-13-8-6-9-14-26)40-37(42-38)27-15-10-7-11-16-27/h6-25H,1-5H3/i6D,8D,9D,13D,14D |
| InChIKey | CSYQEIXTWUGSHR-WWWXGTGTSA-N |
| XLogP | 9.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|