C46H38N2OSi — CID 177088039
[7-[3-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane (PubChem CID 177088039) has the molecular formula C46H38N2OSi and a molecular weight of 662.91 g/mol. Its IUPAC name is [7-[3-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane.
| Compound Name | [7-[3-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177088039 |
| Molecular Formula | C46H38N2OSi |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | [7-[3-(4-dibenzofuran-1-yl-6-phenylpyrimidin-2-yl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane |
| SMILES | CC1(C)c2cc(-c3cccc(-c4nc(-c5ccccc5)cc(-c5cccc6oc7ccccc7c56)n4)c3)ccc2-c2ccc([Si](C)(C)C)cc21 |
| InChI | InChI=1S/C46H38N2OSi/c1-46(2)38-26-31(21-23-34(38)35-24-22-33(27-39(35)46)50(3,4)5)30-15-11-16-32(25-30)45-47-40(29-13-7-6-8-14-29)28-41(48-45)36-18-12-20-43-44(36)37-17-9-10-19-42(37)49-43/h6-28H,1-5H3 |
| InChIKey | MEMSWVVCQLUUAV-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|