C41H37NSi — CID 177088294
[7-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane (PubChem CID 177088294) has the molecular formula C41H37NSi and a molecular weight of 571.84 g/mol. Its IUPAC name is [7-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane.
| Compound Name | [7-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177088294 |
| Molecular Formula | C41H37NSi |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | [7-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-9,9-dimethylfluoren-2-yl]-trimethylsilane |
| SMILES | CC1(C)c2cc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)c3)ccc2-c2ccc([Si](C)(C)C)cc21 |
| InChI | InChI=1S/C41H37NSi/c1-41(2)37-24-32(19-21-35(37)36-22-20-34(27-38(36)41)43(3,4)5)30-17-12-18-31(23-30)33-25-39(28-13-8-6-9-14-28)42-40(26-33)29-15-10-7-11-16-29/h6-27H,1-5H3 |
| InChIKey | PRTYLKZLOHUFNB-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|