C50H41N3Si — CID 177088272
[4-[7-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]-9-methyl-9-phenylfluoren-2-yl]phenyl]-trimethylsilane (PubChem CID 177088272) has the molecular formula C50H41N3Si and a molecular weight of 711.99 g/mol. Its IUPAC name is [4-[7-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]-9-methyl-9-phenylfluoren-2-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[7-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]-9-methyl-9-phenylfluoren-2-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177088272 |
| Molecular Formula | C50H41N3Si |
| Molecular Weight | 711.99 g/mol |
| Exact Mass | 711.31 |
| IUPAC Name | [4-[7-[3-(2,6-dipyridin-4-yl-4-pyridinyl)phenyl]-9-methyl-9-phenylfluoren-2-yl]phenyl]-trimethylsilane |
| SMILES | CC1(c2ccccc2)c2cc(-c3ccc([Si](C)(C)C)cc3)ccc2-c2ccc(-c3cccc(-c4cc(-c5ccncc5)nc(-c5ccncc5)c4)c3)cc21 |
| InChI | InChI=1S/C50H41N3Si/c1-50(42-11-6-5-7-12-42)46-30-39(34-13-17-43(18-14-34)54(2,3)4)15-19-44(46)45-20-16-40(31-47(45)50)37-9-8-10-38(29-37)41-32-48(35-21-25-51-26-22-35)53-49(33-41)36-23-27-52-28-24-36/h5-33H,1-4H3 |
| InChIKey | MAIJFWTWDOSLGM-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.99 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|