C52H35N3 — CID 137452128
4-(9,9-diphenyl-7-pyridin-4-ylfluoren-2-yl)-2-phenyl-6-(3-phenylphenyl)pyrimidine (PubChem CID 137452128) has the molecular formula C52H35N3 and a molecular weight of 701.87 g/mol. Its IUPAC name is 4-(9,9-diphenyl-7-pyridin-4-ylfluoren-2-yl)-2-phenyl-6-(3-phenylphenyl)pyrimidine.
| Compound Name | 4-(9,9-diphenyl-7-pyridin-4-ylfluoren-2-yl)-2-phenyl-6-(3-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 137452128 |
| Molecular Formula | C52H35N3 |
| Molecular Weight | 701.87 g/mol |
| Exact Mass | 701.28 |
| IUPAC Name | 4-(9,9-diphenyl-7-pyridin-4-ylfluoren-2-yl)-2-phenyl-6-(3-phenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4cc(-c6ccncc6)ccc4-5)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C52H35N3/c1-5-14-36(15-6-1)39-18-13-19-41(32-39)49-35-50(55-51(54-49)38-16-7-2-8-17-38)42-25-27-46-45-26-24-40(37-28-30-53-31-29-37)33-47(45)52(48(46)34-42,43-20-9-3-10-21-43)44-22-11-4-12-23-44/h1-35H |
| InChIKey | HSFKCEDMRKJAOJ-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.87 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |