C54H41N3 — CID 142385444
2,4-bis(3-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine;ethane (PubChem CID 142385444) has the molecular formula C54H41N3 and a molecular weight of 731.94 g/mol. Its IUPAC name is 2,4-bis(3-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine;ethane.
| Compound Name | 2,4-bis(3-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine;ethane |
|---|---|
| PubChem CID | 142385444 |
| Molecular Formula | C54H41N3 |
| Molecular Weight | 731.94 g/mol |
| Exact Mass | 731.33 |
| IUPAC Name | 2,4-bis(3-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine;ethane |
| SMILES | CC.c1ccc(-c2cccc(-c3cc(-c4ccc5c(c4)C(c4ccccc4)(c4ccncc4)c4ccccc4-5)nc(-c4cccc(-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C52H35N3.C2H6/c1-4-14-36(15-5-1)38-18-12-20-40(32-38)49-35-50(55-51(54-49)42-21-13-19-39(33-42)37-16-6-2-7-17-37)41-26-27-46-45-24-10-11-25-47(45)52(48(46)34-41,43-22-8-3-9-23-43)44-28-30-53-31-29-44;1-2/h1-35H;1-2H3 |
| InChIKey | LAKGZYYNKVJEMT-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.94 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |