C46H31N3 — CID 142385446
2-phenyl-4-(4-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine (PubChem CID 142385446) has the molecular formula C46H31N3 and a molecular weight of 625.78 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine |
|---|---|
| PubChem CID | 142385446 |
| Molecular Formula | C46H31N3 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-(9-phenyl-9-pyridin-4-ylfluoren-2-yl)pyrimidine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc5c(c4)C(c4ccccc4)(c4ccncc4)c4ccccc4-5)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C46H31N3/c1-4-12-32(13-5-1)33-20-22-34(23-21-33)43-31-44(49-45(48-43)35-14-6-2-7-15-35)36-24-25-40-39-18-10-11-19-41(39)46(42(40)30-36,37-16-8-3-9-17-37)38-26-28-47-29-27-38/h1-31H |
| InChIKey | FYLDLIPYPLEALJ-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |