C47H41NSi — CID 177087843
[4-[7-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]-trimethylsilane (PubChem CID 177087843) has the molecular formula C47H41NSi and a molecular weight of 647.94 g/mol. Its IUPAC name is [4-[7-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[7-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177087843 |
| Molecular Formula | C47H41NSi |
| Molecular Weight | 647.94 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | [4-[7-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9,9-dimethylfluoren-4-yl]phenyl]-trimethylsilane |
| SMILES | CC1(C)c2cc(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)c3)ccc2-c2c(-c3ccc([Si](C)(C)C)cc3)cccc21 |
| InChI | InChI=1S/C47H41NSi/c1-47(2)42-21-13-20-40(33-22-25-39(26-23-33)49(3,4)5)46(42)41-27-24-36(29-43(41)47)35-18-12-19-37(28-35)45-31-38(32-14-8-6-9-15-32)30-44(48-45)34-16-10-7-11-17-34/h6-31H,1-5H3 |
| InChIKey | IVGHEFDGQBVCFE-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.94 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|