C51H43N3Si — CID 176645396
[4-[3-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 176645396) has the molecular formula C51H43N3Si and a molecular weight of 726.01 g/mol. Its IUPAC name is [4-[3-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645396 |
| Molecular Formula | C51H43N3Si |
| Molecular Weight | 726.01 g/mol |
| Exact Mass | 725.32 |
| IUPAC Name | [4-[3-[3-[3-[4-(9,9-dimethylfluoren-2-yl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5cccc(-c6cccc(-c7ccc([Si](C)(C)C)cc7)c6)c5)c4)n3)cc21 |
| InChI | InChI=1S/C51H43N3Si/c1-51(2)46-23-10-9-22-44(46)45-29-26-42(33-47(45)51)50-53-48(35-14-7-6-8-15-35)52-49(54-50)41-21-13-20-40(32-41)39-19-12-18-38(31-39)37-17-11-16-36(30-37)34-24-27-43(28-25-34)55(3,4)5/h6-33H,1-5H3 |
| InChIKey | KRSJTSYITFUJSY-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.01 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|