C50H41NSi — CID 176645644
[4-[4-[4-[3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 176645644) has the molecular formula C50H41NSi and a molecular weight of 683.97 g/mol. Its IUPAC name is [4-[4-[4-[3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[4-[3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 176645644 |
| Molecular Formula | C50H41NSi |
| Molecular Weight | 683.97 g/mol |
| Exact Mass | 683.30 |
| IUPAC Name | [4-[4-[4-[3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(-c3ccc(-c4cccc(-c5cccc(-c6cc(-c7ccccc7)cc(-c7ccccc7)n6)c5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C50H41NSi/c1-52(2,3)48-30-28-40(29-31-48)39-22-20-37(21-23-39)38-24-26-41(27-25-38)43-16-10-17-44(32-43)45-18-11-19-46(33-45)50-35-47(36-12-6-4-7-13-36)34-49(51-50)42-14-8-5-9-15-42/h4-35H,1-3H3 |
| InChIKey | ARVLLGBGEGCXIM-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.97 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|