C62H48N2Si — CID 177088025
[9,9-diphenyl-7-[3-[3-[2-phenyl-6-(3-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]phenyl]fluoren-2-yl]-trimethylsilane (PubChem CID 177088025) has the molecular formula C62H48N2Si and a molecular weight of 849.17 g/mol. Its IUPAC name is [9,9-diphenyl-7-[3-[3-[2-phenyl-6-(3-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]phenyl]fluoren-2-yl]-trimethylsilane.
| Compound Name | [9,9-diphenyl-7-[3-[3-[2-phenyl-6-(3-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]phenyl]fluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177088025 |
| Molecular Formula | C62H48N2Si |
| Molecular Weight | 849.17 g/mol |
| Exact Mass | 848.36 |
| IUPAC Name | [9,9-diphenyl-7-[3-[3-[2-phenyl-6-(3-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]phenyl]fluoren-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(-c3cccc(-c4cccc(-c5cc(-c6ccccc6)nc(-c6cccc(-c7ccccn7)c6)c5)c4)c3)ccc1-2 |
| InChI | InChI=1S/C62H48N2Si/c1-65(2,3)54-32-34-56-55-33-31-48(39-57(55)62(58(56)42-54,52-26-9-5-10-27-52)53-28-11-6-12-29-53)46-22-15-20-44(36-46)45-21-16-23-47(37-45)51-40-60(43-18-7-4-8-19-43)64-61(41-51)50-25-17-24-49(38-50)59-30-13-14-35-63-59/h4-42H,1-3H3 |
| InChIKey | KFEJGSBPRAJGMG-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.17 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|