C56H50Si2 — CID 102177279
[7-(9,9-diphenyl-7-trimethylsilylfluoren-2-yl)-9,9-diphenylfluoren-2-yl]-trimethylsilane (PubChem CID 102177279) has the molecular formula C56H50Si2 and a molecular weight of 779.19 g/mol. Its IUPAC name is [7-(9,9-diphenyl-7-trimethylsilylfluoren-2-yl)-9,9-diphenylfluoren-2-yl]-trimethylsilane.
| Compound Name | [7-(9,9-diphenyl-7-trimethylsilylfluoren-2-yl)-9,9-diphenylfluoren-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102177279 |
| Molecular Formula | C56H50Si2 |
| Molecular Weight | 779.19 g/mol |
| Exact Mass | 778.35 |
| IUPAC Name | [7-(9,9-diphenyl-7-trimethylsilylfluoren-2-yl)-9,9-diphenylfluoren-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc([Si](C)(C)C)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C56H50Si2/c1-57(2,3)45-29-33-49-47-31-27-39(35-51(47)55(53(49)37-45,41-19-11-7-12-20-41)42-21-13-8-14-22-42)40-28-32-48-50-34-30-46(58(4,5)6)38-54(50)56(52(48)36-40,43-23-15-9-16-24-43)44-25-17-10-18-26-44/h7-38H,1-6H3 |
| InChIKey | GSTZLDJDFMZRDV-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.19 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|