C36H27N3 — CID 169060113
2-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 169060113) has the molecular formula C36H27N3 and a molecular weight of 506.66 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169060113 |
| Molecular Formula | C36H27N3 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H27N3/c1-36(2)31-16-10-9-15-29(31)30-22-21-28(23-32(30)36)35-38-33(26-13-7-4-8-14-26)37-34(39-35)27-19-17-25(18-20-27)24-11-5-3-6-12-24/h3-23H,1-2H3/i4D,7D,8D,13D,14D |
| InChIKey | QKNUMTBBUWYMFW-KVKRPVSRSA-N |
| XLogP | 8.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |