C59H35N3 — CID 58273822
2-(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine (PubChem CID 58273822) has the molecular formula C59H35N3 and a molecular weight of 790.98 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58273822 |
| Molecular Formula | C59H35N3 |
| Molecular Weight | 790.98 g/mol |
| Exact Mass | 790.31 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4,6-bis(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3ccccc3-4)nc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3ccccc3-4)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C59H35N3/c1-2-16-36(17-3-1)55-60-56(37-30-32-45-43-22-8-14-28-51(43)58(53(45)34-37)47-24-10-4-18-39(47)40-19-5-11-25-48(40)58)62-57(61-55)38-31-33-46-44-23-9-15-29-52(44)59(54(46)35-38)49-26-12-6-20-41(49)42-21-7-13-27-50(42)59/h1-35H/i1D,2D,3D,16D,17D |
| InChIKey | OIHUMLVIKWJNJK-BDNQOSTESA-N |
| XLogP | 13.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.98 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |