C24H19N3 — CID 118245468
2-(9,9-dimethylfluoren-2-yl)-4-phenyl-1,3,5-triazine (PubChem CID 118245468) has the molecular formula C24H19N3 and a molecular weight of 349.44 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-2-yl)-4-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-2-yl)-4-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118245468 |
| Molecular Formula | C24H19N3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-(9,9-dimethylfluoren-2-yl)-4-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ncnc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C24H19N3/c1-24(2)20-11-7-6-10-18(20)19-13-12-17(14-21(19)24)23-26-15-25-22(27-23)16-8-4-3-5-9-16/h3-15H,1-2H3 |
| InChIKey | JJGMDQMLYMMXCH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |