C55H41N3Si — CID 177088237
[4-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-3-yl]phenyl]-trimethylsilane (PubChem CID 177088237) has the molecular formula C55H41N3Si and a molecular weight of 772.04 g/mol. Its IUPAC name is [4-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-3-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-3-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 177088237 |
| Molecular Formula | C55H41N3Si |
| Molecular Weight | 772.04 g/mol |
| Exact Mass | 771.31 |
| IUPAC Name | [4-[7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9'-spirobi[fluorene]-3-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc3c(c2)-c2ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc2C32c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C55H41N3Si/c1-59(2,3)43-29-25-36(26-30-43)40-28-32-50-47(34-40)46-31-27-41(35-51(46)55(50)48-23-12-10-21-44(48)45-22-11-13-24-49(45)55)39-19-14-20-42(33-39)54-57-52(37-15-6-4-7-16-37)56-53(58-54)38-17-8-5-9-18-38/h4-35H,1-3H3 |
| InChIKey | BXALGBOLQIGCKN-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.04 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|