C33H32O — CID 90153663
2,7-ditert-butylspiro[fluorene-9,9'-xanthene] (PubChem CID 90153663) has the molecular formula C33H32O and a molecular weight of 444.62 g/mol. Its IUPAC name is 2,7-ditert-butylspiro[fluorene-9,9'-xanthene].
| Compound Name | 2,7-ditert-butylspiro[fluorene-9,9'-xanthene] |
|---|---|
| PubChem CID | 90153663 |
| Molecular Formula | C33H32O |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2,7-ditert-butylspiro[fluorene-9,9'-xanthene] |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3Oc3ccccc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C33H32O/c1-31(2,3)21-15-17-23-24-18-16-22(32(4,5)6)20-28(24)33(27(23)19-21)25-11-7-9-13-29(25)34-30-14-10-8-12-26(30)33/h7-20H,1-6H3 |
| InChIKey | GHZPAYBZBTVPKH-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |