C54H48O — CID 177127900
2-[2-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-9,9-dimethylxanthene (PubChem CID 177127900) has the molecular formula C54H48O and a molecular weight of 712.98 g/mol. Its IUPAC name is 2-[2-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-9,9-dimethylxanthene.
| Compound Name | 2-[2-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-9,9-dimethylxanthene |
|---|---|
| PubChem CID | 177127900 |
| Molecular Formula | C54H48O |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.37 |
| IUPAC Name | 2-[2-(2',7'-ditert-butyl-9,9'-spirobi[fluorene]-2-yl)phenyl]-9,9-dimethylxanthene |
| SMILES | CC(C)(C)c1ccc2c(c1)C1(c3ccccc3-c3ccc(-c4ccccc4-c4ccc5c(c4)C(C)(C)c4ccccc4O5)cc31)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C54H48O/c1-51(2,3)35-23-26-41-42-27-24-36(52(4,5)6)32-47(42)54(46(41)31-35)43-18-12-11-17-39(43)40-25-21-33(29-45(40)54)37-15-9-10-16-38(37)34-22-28-50-48(30-34)53(7,8)44-19-13-14-20-49(44)55-50/h9-32H,1-8H3 |
| InChIKey | QKQIUBIECRJIIH-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |