C27H14F6O — CID 118965533
2,7-bis(trifluoromethyl)spiro[fluorene-9,9'-xanthene] (PubChem CID 118965533) has the molecular formula C27H14F6O and a molecular weight of 468.40 g/mol. Its IUPAC name is 2,7-bis(trifluoromethyl)spiro[fluorene-9,9'-xanthene].
| Compound Name | 2,7-bis(trifluoromethyl)spiro[fluorene-9,9'-xanthene] |
|---|---|
| PubChem CID | 118965533 |
| Molecular Formula | C27H14F6O |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2,7-bis(trifluoromethyl)spiro[fluorene-9,9'-xanthene] |
| SMILES | FC(F)(F)c1ccc2c(c1)C1(c3ccccc3Oc3ccccc31)c1cc(C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C27H14F6O/c28-26(29,30)15-9-11-17-18-12-10-16(27(31,32)33)14-22(18)25(21(17)13-15)19-5-1-3-7-23(19)34-24-8-4-2-6-20(24)25/h1-14H |
| InChIKey | MAJLXAWEHKKZTA-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |