C43H46N2 — CID 141125012
2,7-ditert-butyl-1'-(4-tert-butylphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine (PubChem CID 141125012) has the molecular formula C43H46N2 and a molecular weight of 590.86 g/mol. Its IUPAC name is 2,7-ditert-butyl-1'-(4-tert-butylphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine.
| Compound Name | 2,7-ditert-butyl-1'-(4-tert-butylphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine |
|---|---|
| PubChem CID | 141125012 |
| Molecular Formula | C43H46N2 |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | 2,7-ditert-butyl-1'-(4-tert-butylphenyl)-9,9'-spirobi[fluorene]-2',7'-diamine |
| SMILES | CC(C)(C)c1ccc(-c2c(N)ccc3c2C2(c4cc(C(C)(C)C)ccc4-c4ccc(C(C)(C)C)cc42)c2cc(N)ccc2-3)cc1 |
| InChI | InChI=1S/C43H46N2/c1-40(2,3)26-12-10-25(11-13-26)38-37(45)21-20-33-32-19-16-29(44)24-36(32)43(39(33)38)34-22-27(41(4,5)6)14-17-30(34)31-18-15-28(23-35(31)43)42(7,8)9/h10-24H,44-45H2,1-9H3 |
| InChIKey | DGTPMRLLZCEQSX-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|