C35H31N — CID 156902961
7-(3-tert-butylphenyl)-9,9-diphenylfluoren-2-amine (PubChem CID 156902961) has the molecular formula C35H31N and a molecular weight of 465.64 g/mol. Its IUPAC name is 7-(3-tert-butylphenyl)-9,9-diphenylfluoren-2-amine.
| Compound Name | 7-(3-tert-butylphenyl)-9,9-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 156902961 |
| Molecular Formula | C35H31N |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 7-(3-tert-butylphenyl)-9,9-diphenylfluoren-2-amine |
| SMILES | CC(C)(C)c1cccc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(N)ccc2-3)c1 |
| InChI | InChI=1S/C35H31N/c1-34(2,3)28-16-10-11-24(21-28)25-17-19-30-31-20-18-29(36)23-33(31)35(32(30)22-25,26-12-6-4-7-13-26)27-14-8-5-9-15-27/h4-23H,36H2,1-3H3 |
| InChIKey | ZHHLZONBIZGTQP-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|