C74H67N — CID 176622694
6-tert-butyl-9,9-bis(4-tert-butylphenyl)-N-(9,9-diphenylfluoren-2-yl)-N-(3-phenylphenyl)fluoren-2-amine (PubChem CID 176622694) has the molecular formula C74H67N and a molecular weight of 970.36 g/mol. Its IUPAC name is 6-tert-butyl-9,9-bis(4-tert-butylphenyl)-N-(9,9-diphenylfluoren-2-yl)-N-(3-phenylphenyl)fluoren-2-amine.
| Compound Name | 6-tert-butyl-9,9-bis(4-tert-butylphenyl)-N-(9,9-diphenylfluoren-2-yl)-N-(3-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 176622694 |
| Molecular Formula | C74H67N |
| Molecular Weight | 970.36 g/mol |
| Exact Mass | 969.53 |
| IUPAC Name | 6-tert-butyl-9,9-bis(4-tert-butylphenyl)-N-(9,9-diphenylfluoren-2-yl)-N-(3-phenylphenyl)fluoren-2-amine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3-c3ccc(N(c4cccc(-c5ccccc5)c4)c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)cc32)cc1 |
| InChI | InChI=1S/C74H67N/c1-70(2,3)52-32-36-56(37-33-52)74(57-38-34-53(35-39-57)71(4,5)6)67-45-40-58(72(7,8)9)47-65(67)64-44-42-61(49-69(64)74)75(59-29-21-24-51(46-59)50-22-13-10-14-23-50)60-41-43-63-62-30-19-20-31-66(62)73(68(63)48-60,54-25-15-11-16-26-54)55-27-17-12-18-28-55/h10-49H,1-9H3 |
| InChIKey | LTUASAZQLSIIHS-UHFFFAOYSA-N |
| XLogP | 19.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.36 |
| LogP ≤ 5 | 19.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |