C73H63N — CID 171453091
N-[9,9-bis(4-tert-butylphenyl)fluoren-3-yl]-9-methyl-N-(9-methyl-9-phenylfluoren-2-yl)-9-phenylfluoren-2-amine (PubChem CID 171453091) has the molecular formula C73H63N and a molecular weight of 954.31 g/mol. Its IUPAC name is N-[9,9-bis(4-tert-butylphenyl)fluoren-3-yl]-9-methyl-N-(9-methyl-9-phenylfluoren-2-yl)-9-phenylfluoren-2-amine.
| Compound Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-3-yl]-9-methyl-N-(9-methyl-9-phenylfluoren-2-yl)-9-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 171453091 |
| Molecular Formula | C73H63N |
| Molecular Weight | 954.31 g/mol |
| Exact Mass | 953.50 |
| IUPAC Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-3-yl]-9-methyl-N-(9-methyl-9-phenylfluoren-2-yl)-9-phenylfluoren-2-amine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3cc(N(c4ccc5c(c4)C(C)(c4ccccc4)c4ccccc4-5)c4ccc5c(c4)C(C)(c4ccccc4)c4ccccc4-5)ccc32)cc1 |
| InChI | InChI=1S/C73H63N/c1-69(2,3)48-31-35-52(36-32-48)73(53-37-33-49(34-38-53)70(4,5)6)65-30-20-17-27-59(65)62-45-54(41-44-66(62)73)74(55-39-42-60-57-25-15-18-28-63(57)71(7,67(60)46-55)50-21-11-9-12-22-50)56-40-43-61-58-26-16-19-29-64(58)72(8,68(61)47-56)51-23-13-10-14-24-51/h9-47H,1-8H3 |
| InChIKey | LQYRKCQCJRDDPF-UHFFFAOYSA-N |
| XLogP | 18.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.31 |
| LogP ≤ 5 | 18.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |