C66H59N — CID 177067384
9,9-bis(4-tert-butylphenyl)-N-[9-(3,5-dimethylphenyl)-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine (PubChem CID 177067384) has the molecular formula C66H59N and a molecular weight of 866.20 g/mol. Its IUPAC name is 9,9-bis(4-tert-butylphenyl)-N-[9-(3,5-dimethylphenyl)-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine.
| Compound Name | 9,9-bis(4-tert-butylphenyl)-N-[9-(3,5-dimethylphenyl)-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 177067384 |
| Molecular Formula | C66H59N |
| Molecular Weight | 866.20 g/mol |
| Exact Mass | 865.46 |
| IUPAC Name | 9,9-bis(4-tert-butylphenyl)-N-[9-(3,5-dimethylphenyl)-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine |
| SMILES | Cc1cc(C)cc(C2(c3ccccc3)c3ccccc3-c3ccc(N(c4ccccc4)c4ccc5c(c4)C(c4ccc(C(C)(C)C)cc4)(c4ccc(C(C)(C)C)cc4)c4ccccc4-5)cc32)c1 |
| InChI | InChI=1S/C66H59N/c1-44-39-45(2)41-51(40-44)66(48-19-11-9-12-20-48)60-26-18-16-24-56(60)58-38-36-54(43-62(58)66)67(52-21-13-10-14-22-52)53-35-37-57-55-23-15-17-25-59(55)65(61(57)42-53,49-31-27-46(28-32-49)63(3,4)5)50-33-29-47(30-34-50)64(6,7)8/h9-43H,1-8H3 |
| InChIKey | DZEPQPCJIIMSFM-UHFFFAOYSA-N |
| XLogP | 17.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.20 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |