C70H67N — CID 177067292
9,9-bis(4-tert-butylphenyl)-N-[9-[3,5-di(propan-2-yl)phenyl]-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine (PubChem CID 177067292) has the molecular formula C70H67N and a molecular weight of 922.31 g/mol. Its IUPAC name is 9,9-bis(4-tert-butylphenyl)-N-[9-[3,5-di(propan-2-yl)phenyl]-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine.
| Compound Name | 9,9-bis(4-tert-butylphenyl)-N-[9-[3,5-di(propan-2-yl)phenyl]-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 177067292 |
| Molecular Formula | C70H67N |
| Molecular Weight | 922.31 g/mol |
| Exact Mass | 921.53 |
| IUPAC Name | 9,9-bis(4-tert-butylphenyl)-N-[9-[3,5-di(propan-2-yl)phenyl]-9-phenylfluoren-2-yl]-N-phenylfluoren-2-amine |
| SMILES | CC(C)c1cc(C(C)C)cc(C2(c3ccccc3)c3ccccc3-c3ccc(N(c4ccccc4)c4ccc5c(c4)C(c4ccc(C(C)(C)C)cc4)(c4ccc(C(C)(C)C)cc4)c4ccccc4-5)cc32)c1 |
| InChI | InChI=1S/C70H67N/c1-46(2)48-41-49(47(3)4)43-55(42-48)70(52-21-13-11-14-22-52)64-28-20-18-26-60(64)62-40-38-58(45-66(62)70)71(56-23-15-12-16-24-56)57-37-39-61-59-25-17-19-27-63(59)69(65(61)44-57,53-33-29-50(30-34-53)67(5,6)7)54-35-31-51(32-36-54)68(8,9)10/h11-47H,1-10H3 |
| InChIKey | HWLVHLUYGLYTJT-UHFFFAOYSA-N |
| XLogP | 18.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.31 |
| LogP ≤ 5 | 18.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |