C74H65N — CID 177067157
N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2-tert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 177067157) has the molecular formula C74H65N and a molecular weight of 968.34 g/mol. Its IUPAC name is N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2-tert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2-tert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 177067157 |
| Molecular Formula | C74H65N |
| Molecular Weight | 968.34 g/mol |
| Exact Mass | 967.51 |
| IUPAC Name | N-[9,9-bis(4-tert-butylphenyl)fluoren-2-yl]-2-tert-butyl-N-(3-phenylphenyl)-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3ccccc3-c3ccc(N(c4cccc(-c5ccccc5)c4)c4ccc5c(c4)C4(c6ccccc6-5)c5ccccc5-c5ccc(C(C)(C)C)cc54)cc32)cc1 |
| InChI | InChI=1S/C74H65N/c1-70(2,3)50-30-34-52(35-31-50)73(53-36-32-51(33-37-53)71(4,5)6)64-27-16-13-24-58(64)62-42-39-56(46-68(62)73)75(55-23-19-22-49(44-55)48-20-11-10-12-21-48)57-40-43-63-60-26-15-18-29-66(60)74(69(63)47-57)65-28-17-14-25-59(65)61-41-38-54(45-67(61)74)72(7,8)9/h10-47H,1-9H3 |
| InChIKey | BXROOAGKDUXPNI-UHFFFAOYSA-N |
| XLogP | 19.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.34 |
| LogP ≤ 5 | 19.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |